C16H24FNO6 — CID 170832651
tert-butyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 170832651) has the molecular formula C16H24FNO6 and a molecular weight of 345.37 g/mol. Its IUPAC name is tert-butyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832651 |
| Molecular Formula | C16H24FNO6 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | tert-butyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | COCOc1ccc(C(O)C(O)CNC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C16H24FNO6/c1-16(2,3)24-15(21)18-8-13(19)14(20)11-6-5-10(7-12(11)17)23-9-22-4/h5-7,13-14,19-20H,8-9H2,1-4H3,(H,18,21) |
| InChIKey | QHFDFVOZHAVXLL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|