C27H28FNO6 — CID 171887169
9H-fluoren-9-ylmethyl N-[4-[2-fluoro-4-(methoxymethoxy)phenyl]-3,4-dihydroxybutyl]carbamate (PubChem CID 171887169) has the molecular formula C27H28FNO6 and a molecular weight of 481.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[2-fluoro-4-(methoxymethoxy)phenyl]-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[2-fluoro-4-(methoxymethoxy)phenyl]-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887169 |
| Molecular Formula | C27H28FNO6 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[2-fluoro-4-(methoxymethoxy)phenyl]-3,4-dihydroxybutyl]carbamate |
| SMILES | COCOc1ccc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C27H28FNO6/c1-33-16-35-17-10-11-22(24(28)14-17)26(31)25(30)12-13-29-27(32)34-15-23-20-8-4-2-6-18(20)19-7-3-5-9-21(19)23/h2-11,14,23,25-26,30-31H,12-13,15-16H2,1H3,(H,29,32) |
| InChIKey | STOPTSHDMFYTFA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|