C26H26FNO6 — CID 170834709
9H-fluoren-9-ylmethyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 170834709) has the molecular formula C26H26FNO6 and a molecular weight of 467.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834709 |
| Molecular Formula | C26H26FNO6 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[2-fluoro-4-(methoxymethoxy)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | COCOc1ccc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C26H26FNO6/c1-32-15-34-16-10-11-21(23(27)12-16)25(30)24(29)13-28-26(31)33-14-22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22/h2-12,22,24-25,29-30H,13-15H2,1H3,(H,28,31) |
| InChIKey | CFCCGYFBILPCCI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|