C25H25NO4 — CID 170833599
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methylphenyl)propyl]carbamate (PubChem CID 170833599) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methylphenyl)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170833599 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methylphenyl)propyl]carbamate |
| SMILES | Cc1ccccc1C(O)C(O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H25NO4/c1-16-8-2-3-9-17(16)24(28)23(27)14-26-25(29)30-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h2-13,22-24,27-28H,14-15H2,1H3,(H,26,29) |
| InChIKey | YVAKBNUNQAGXOH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |