C28H25NO4 — CID 170834360
9H-fluoren-9-ylmethyl N-(2,3-dihydroxy-3-naphthalen-1-ylpropyl)carbamate (PubChem CID 170834360) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(2,3-dihydroxy-3-naphthalen-1-ylpropyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(2,3-dihydroxy-3-naphthalen-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 170834360 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(2,3-dihydroxy-3-naphthalen-1-ylpropyl)carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc2ccccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H25NO4/c30-26(27(31)24-15-7-9-18-8-1-2-10-19(18)24)16-29-28(32)33-17-25-22-13-5-3-11-20(22)21-12-4-6-14-23(21)25/h1-15,25-27,30-31H,16-17H2,(H,29,32) |
| InChIKey | HVGGJNFYAJMBIG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |