C24H21Cl2NO4 — CID 170833738
9H-fluoren-9-ylmethyl N-[3-(2,6-dichlorophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833738) has the molecular formula C24H21Cl2NO4 and a molecular weight of 458.34 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,6-dichlorophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,6-dichlorophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833738 |
| Molecular Formula | C24H21Cl2NO4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,6-dichlorophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1c(Cl)cccc1Cl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21Cl2NO4/c25-19-10-5-11-20(26)22(19)23(29)21(28)12-27-24(30)31-13-18-16-8-3-1-6-14(16)15-7-2-4-9-17(15)18/h1-11,18,21,23,28-29H,12-13H2,(H,27,30) |
| InChIKey | PFQCUNUUKAPQAN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |