C26H24ClNO6 — CID 171886895
3-chloro-2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]benzoic acid (PubChem CID 171886895) has the molecular formula C26H24ClNO6 and a molecular weight of 481.93 g/mol. Its IUPAC name is 3-chloro-2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]benzoic acid.
| Compound Name | 3-chloro-2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]benzoic acid |
|---|---|
| PubChem CID | 171886895 |
| Molecular Formula | C26H24ClNO6 |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-chloro-2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]benzoic acid |
| SMILES | O=C(NCCC(O)C(O)c1c(Cl)cccc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H24ClNO6/c27-21-11-5-10-19(25(31)32)23(21)24(30)22(29)12-13-28-26(33)34-14-20-17-8-3-1-6-15(17)16-7-2-4-9-18(16)20/h1-11,20,22,24,29-30H,12-14H2,(H,28,33)(H,31,32) |
| InChIKey | RYUKXYPMHDQKRF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |