C28H26N2O6 — CID 171887462
3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-1H-indole-2-carboxylic acid (PubChem CID 171887462) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171887462 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(NCCC(O)C(O)c1c(C(=O)O)[nH]c2ccccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H26N2O6/c31-23(26(32)24-20-11-5-6-12-22(20)30-25(24)27(33)34)13-14-29-28(35)36-15-21-18-9-3-1-7-16(18)17-8-2-4-10-19(17)21/h1-12,21,23,26,30-32H,13-15H2,(H,29,35)(H,33,34) |
| InChIKey | DYAAXERLDNKYGR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|