C27H25NO8 — CID 171887483
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]terephthalic acid (PubChem CID 171887483) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]terephthalic acid.
| Compound Name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]terephthalic acid |
|---|---|
| PubChem CID | 171887483 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]terephthalic acid |
| SMILES | O=C(NCCC(O)C(O)c1cc(C(=O)O)ccc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H25NO8/c29-23(24(30)21-13-15(25(31)32)9-10-20(21)26(33)34)11-12-28-27(35)36-14-22-18-7-3-1-5-16(18)17-6-2-4-8-19(17)22/h1-10,13,22-24,29-30H,11-12,14H2,(H,28,35)(H,31,32)(H,33,34) |
| InChIKey | OHRLZSAMJORFRK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |