C27H30N2O4 — CID 171886687
9H-fluoren-9-ylmethyl N-[4-(4-amino-2,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886687) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-amino-2,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-2,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886687 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-2,5-dimethylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Cc1cc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)c(C)cc1N |
| InChI | InChI=1S/C27H30N2O4/c1-16-14-24(28)17(2)13-22(16)26(31)25(30)11-12-29-27(32)33-15-23-20-9-5-3-7-18(20)19-8-4-6-10-21(19)23/h3-10,13-14,23,25-26,30-31H,11-12,15,28H2,1-2H3,(H,29,32) |
| InChIKey | DWHXDFRVBNQLQE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|