C27H26N2O4 — CID 171886696
9H-fluoren-9-ylmethyl N-[4-(2-cyano-5-methylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886696) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-cyano-5-methylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-cyano-5-methylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886696 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-cyano-5-methylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Cc1ccc(C#N)c(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-17-10-11-18(15-28)23(14-17)26(31)25(30)12-13-29-27(32)33-16-24-21-8-4-2-6-19(21)20-7-3-5-9-22(20)24/h2-11,14,24-26,30-31H,12-13,16H2,1H3,(H,29,32) |
| InChIKey | JBYGXGYIDGYWRN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |