C27H29NO5 — CID 171886565
9H-fluoren-9-ylmethyl N-[4-(2-ethoxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886565) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-ethoxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-ethoxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886565 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-ethoxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CCOc1ccccc1C(O)C(O)CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H29NO5/c1-2-32-25-14-8-7-13-22(25)26(30)24(29)15-16-28-27(31)33-17-23-20-11-5-3-9-18(20)19-10-4-6-12-21(19)23/h3-14,23-24,26,29-30H,2,15-17H2,1H3,(H,28,31) |
| InChIKey | GYVAQRXSTOZLEZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |