C26H25FN2O6 — CID 171887298
2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-4-fluorobenzoic acid (PubChem CID 171887298) has the molecular formula C26H25FN2O6 and a molecular weight of 480.49 g/mol. Its IUPAC name is 2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-4-fluorobenzoic acid.
| Compound Name | 2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 171887298 |
| Molecular Formula | C26H25FN2O6 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxybutyl]-4-fluorobenzoic acid |
| SMILES | Nc1cc(F)c(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C26H25FN2O6/c27-21-12-22(28)19(25(32)33)11-18(21)24(31)23(30)9-10-29-26(34)35-13-20-16-7-3-1-5-14(16)15-6-2-4-8-17(15)20/h1-8,11-12,20,23-24,30-31H,9-10,13,28H2,(H,29,34)(H,32,33) |
| InChIKey | MYGDZZBVVGHEQZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|