C26H24F4N2O4 — CID 171887545
9H-fluoren-9-ylmethyl N-[4-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate (PubChem CID 171887545) has the molecular formula C26H24F4N2O4 and a molecular weight of 504.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887545 |
| Molecular Formula | C26H24F4N2O4 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1cc(C(F)(F)F)c(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1F |
| InChI | InChI=1S/C26H24F4N2O4/c27-21-11-18(20(12-22(21)31)26(28,29)30)24(34)23(33)9-10-32-25(35)36-13-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-8,11-12,19,23-24,33-34H,9-10,13,31H2,(H,32,35) |
| InChIKey | HVRMXBJMXXTQHH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|