C25H22ClF2NO4 — CID 171886453
9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886453) has the molecular formula C25H22ClF2NO4 and a molecular weight of 473.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886453 |
| Molecular Formula | C25H22ClF2NO4 |
| Molecular Weight | 473.90 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc(F)c(Cl)c1F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22ClF2NO4/c26-22-20(27)10-9-18(23(22)28)24(31)21(30)11-12-29-25(32)33-13-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-10,19,21,24,30-31H,11-13H2,(H,29,32) |
| InChIKey | MVBHWDYHANBRGC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|