C25H22Cl2FNO4 — CID 171886457
9H-fluoren-9-ylmethyl N-[4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886457) has the molecular formula C25H22Cl2FNO4 and a molecular weight of 490.36 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886457 |
| Molecular Formula | C25H22Cl2FNO4 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc(Cl)c(F)c(Cl)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22Cl2FNO4/c26-20-11-14(12-21(27)23(20)28)24(31)22(30)9-10-29-25(32)33-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,11-12,19,22,24,30-31H,9-10,13H2,(H,29,32) |
| InChIKey | RDWRFNCURWSYBB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|