C29H27NO4 — CID 171886819
9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-naphthalen-2-ylbutyl)carbamate (PubChem CID 171886819) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-naphthalen-2-ylbutyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-naphthalen-2-ylbutyl)carbamate |
|---|---|
| PubChem CID | 171886819 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-naphthalen-2-ylbutyl)carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc2ccccc2c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H27NO4/c31-27(28(32)21-14-13-19-7-1-2-8-20(19)17-21)15-16-30-29(33)34-18-26-24-11-5-3-9-22(24)23-10-4-6-12-25(23)26/h1-14,17,26-28,31-32H,15-16,18H2,(H,30,33) |
| InChIKey | KUTVBHAEXSWWAR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |