C27H29NO6 — CID 171886928
9H-fluoren-9-ylmethyl N-[4-(3,5-dimethoxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886928) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3,5-dimethoxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3,5-dimethoxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886928 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3,5-dimethoxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | COc1cc(OC)cc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C27H29NO6/c1-32-18-13-17(14-19(15-18)33-2)26(30)25(29)11-12-28-27(31)34-16-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-10,13-15,24-26,29-30H,11-12,16H2,1-2H3,(H,28,31) |
| InChIKey | UYVCHUGTZOURJS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |