C32H29NO4 — CID 171887623
9H-fluoren-9-ylmethyl N-[4-(9H-fluoren-2-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887623) has the molecular formula C32H29NO4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(9H-fluoren-2-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(9H-fluoren-2-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887623 |
| Molecular Formula | C32H29NO4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(9H-fluoren-2-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc2c(c1)Cc1ccccc1-2)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H29NO4/c34-30(31(35)21-13-14-24-22(18-21)17-20-7-1-2-8-23(20)24)15-16-33-32(36)37-19-29-27-11-5-3-9-25(27)26-10-4-6-12-28(26)29/h1-14,18,29-31,34-35H,15-17,19H2,(H,33,36) |
| InChIKey | ZOPCRBTYBAZMSQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |