C28H26N2O4 — CID 171886846
9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-quinolin-6-ylbutyl)carbamate (PubChem CID 171886846) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-quinolin-6-ylbutyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-quinolin-6-ylbutyl)carbamate |
|---|---|
| PubChem CID | 171886846 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(3,4-dihydroxy-4-quinolin-6-ylbutyl)carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc2ncccc2c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H26N2O4/c31-26(27(32)19-11-12-25-18(16-19)6-5-14-29-25)13-15-30-28(33)34-17-24-22-9-3-1-7-20(22)21-8-2-4-10-23(21)24/h1-12,14,16,24,26-27,31-32H,13,15,17H2,(H,30,33) |
| InChIKey | LKXSPWJNLYRBGT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |