C26H22F2N2O4 — CID 171887054
9H-fluoren-9-ylmethyl N-[4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887054) has the molecular formula C26H22F2N2O4 and a molecular weight of 464.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887054 |
| Molecular Formula | C26H22F2N2O4 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1c(F)cc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1F |
| InChI | InChI=1S/C26H22F2N2O4/c27-22-11-15(12-23(28)20(22)13-29)25(32)24(31)9-10-30-26(33)34-14-21-18-7-3-1-5-16(18)17-6-2-4-8-19(17)21/h1-8,11-12,21,24-25,31-32H,9-10,14H2,(H,30,33) |
| InChIKey | DLRSGUZGQMLCBU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |