C24H20Cl2FNO4 — CID 170833989
9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833989) has the molecular formula C24H20Cl2FNO4 and a molecular weight of 476.33 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833989 |
| Molecular Formula | C24H20Cl2FNO4 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cc(Cl)cc(F)c1Cl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H20Cl2FNO4/c25-13-9-18(22(26)20(27)10-13)23(30)21(29)11-28-24(31)32-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-10,19,21,23,29-30H,11-12H2,(H,28,31) |
| InChIKey | ZICDXWHPFBJVFX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|