C24H23ClN2O5 — CID 170834280
9H-fluoren-9-ylmethyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170834280) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834280 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3-amino-5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Nc1cc(Cl)cc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)c1O |
| InChI | InChI=1S/C24H23ClN2O5/c25-13-9-18(22(29)20(26)10-13)23(30)21(28)11-27-24(31)32-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-10,19,21,23,28-30H,11-12,26H2,(H,27,31) |
| InChIKey | AZZNYHGURXCMJQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|