C26H24ClNO6 — CID 171886891
9H-fluoren-9-ylmethyl N-[4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886891) has the molecular formula C26H24ClNO6 and a molecular weight of 481.93 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886891 |
| Molecular Formula | C26H24ClNO6 |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(5-chloro-3-formyl-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=Cc1cc(Cl)cc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)c1O |
| InChI | InChI=1S/C26H24ClNO6/c27-16-11-15(13-29)24(31)21(12-16)25(32)23(30)9-10-28-26(33)34-14-22-19-7-3-1-5-17(19)18-6-2-4-8-20(18)22/h1-8,11-13,22-23,25,30-32H,9-10,14H2,(H,28,33) |
| InChIKey | LHGBKQHJCFRMGV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|