C25H22ClNO5 — CID 170834057
9H-fluoren-9-ylmethyl N-[3-(4-chloro-2-formylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170834057) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-chloro-2-formylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-chloro-2-formylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834057 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-chloro-2-formylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1cc(Cl)ccc1C(O)C(O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22ClNO5/c26-16-9-10-17(15(11-16)13-28)24(30)23(29)12-27-25(31)32-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-11,13,22-24,29-30H,12,14H2,(H,27,31) |
| InChIKey | LBMMHCBWCLWBQF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|