C27H27NO7 — CID 171887233
9H-fluoren-9-ylmethyl N-[4-(2-formyl-5-hydroxy-4-methoxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887233) has the molecular formula C27H27NO7 and a molecular weight of 477.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-formyl-5-hydroxy-4-methoxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-formyl-5-hydroxy-4-methoxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887233 |
| Molecular Formula | C27H27NO7 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-formyl-5-hydroxy-4-methoxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | COc1cc(C=O)c(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1O |
| InChI | InChI=1S/C27H27NO7/c1-34-25-12-16(14-29)21(13-24(25)31)26(32)23(30)10-11-28-27(33)35-15-22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22/h2-9,12-14,22-23,26,30-32H,10-11,15H2,1H3,(H,28,33) |
| InChIKey | IXAXWILDSHKMPM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|