C27H25NO7 — CID 171887379
9H-fluoren-9-ylmethyl N-[4-(6-formyl-1,3-benzodioxol-5-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887379) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(6-formyl-1,3-benzodioxol-5-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(6-formyl-1,3-benzodioxol-5-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887379 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(6-formyl-1,3-benzodioxol-5-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=Cc1cc2c(cc1C(O)C(O)CCNC(=O)OCC1c3ccccc3-c3ccccc31)OCO2 |
| InChI | InChI=1S/C27H25NO7/c29-13-16-11-24-25(35-15-34-24)12-21(16)26(31)23(30)9-10-28-27(32)33-14-22-19-7-3-1-5-17(19)18-6-2-4-8-20(18)22/h1-8,11-13,22-23,26,30-31H,9-10,14-15H2,(H,28,32) |
| InChIKey | MYOGAVSHIJVRFA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|