C26H24ClNO5 — CID 171886536
9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171886536) has the molecular formula C26H24ClNO5 and a molecular weight of 465.93 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171886536 |
| Molecular Formula | C26H24ClNO5 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=Cc1cccc(Cl)c1C(O)C(O)CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H24ClNO5/c27-22-11-5-6-16(14-29)24(22)25(31)23(30)12-13-28-26(32)33-15-21-19-9-3-1-7-17(19)18-8-2-4-10-20(18)21/h1-11,14,21,23,25,30-31H,12-13,15H2,(H,28,32) |
| InChIKey | FKXIGCQEMFSLNK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|