C24H25N3O4 — CID 170833835
9H-fluoren-9-ylmethyl N-[3-(2-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833835) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833835 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | NNc1ccccc1C(O)C(O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H25N3O4/c25-27-21-12-6-5-11-19(21)23(29)22(28)13-26-24(30)31-14-20-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20/h1-12,20,22-23,27-29H,13-14,25H2,(H,26,30) |
| InChIKey | FVPXZYLIRYZPGK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|