C14H21FN2O4 — CID 170831836
tert-butyl N-[3-(2-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170831836) has the molecular formula C14H21FN2O4 and a molecular weight of 300.33 g/mol. Its IUPAC name is tert-butyl N-[3-(2-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170831836 |
| Molecular Formula | C14H21FN2O4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | tert-butyl N-[3-(2-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Cc1cnc(F)c(C(O)C(O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H21FN2O4/c1-8-5-9(12(15)16-6-8)11(19)10(18)7-17-13(20)21-14(2,3)4/h5-6,10-11,18-19H,7H2,1-4H3,(H,17,20) |
| InChIKey | SGCFJXIUISKYAJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|