C14H19F2NO4 — CID 170831686
tert-butyl N-[3-(2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170831686) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is tert-butyl N-[3-(2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170831686 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | tert-butyl N-[3-(2,5-difluorophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2NO4/c1-14(2,3)21-13(20)17-7-11(18)12(19)9-6-8(15)4-5-10(9)16/h4-6,11-12,18-19H,7H2,1-3H3,(H,17,20) |
| InChIKey | YZHDSHOMSKUNHD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |