C17H26F2N2O2 — CID 107251325
tert-butyl N-[2-[1-(2,5-difluorophenyl)ethylamino]butyl]carbamate (PubChem CID 107251325) has the molecular formula C17H26F2N2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2,5-difluorophenyl)ethylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2,5-difluorophenyl)ethylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107251325 |
| Molecular Formula | C17H26F2N2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | tert-butyl N-[2-[1-(2,5-difluorophenyl)ethylamino]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)NC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H26F2N2O2/c1-6-13(10-20-16(22)23-17(3,4)5)21-11(2)14-9-12(18)7-8-15(14)19/h7-9,11,13,21H,6,10H2,1-5H3,(H,20,22) |
| InChIKey | FHZSFIYJUYZPLC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |