C15H22F2N2O3 — CID 83936067
tert-butyl N-[3-amino-4-(2,5-difluorophenyl)-4-hydroxybutyl]carbamate (PubChem CID 83936067) has the molecular formula C15H22F2N2O3 and a molecular weight of 316.35 g/mol. Its IUPAC name is tert-butyl N-[3-amino-4-(2,5-difluorophenyl)-4-hydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-4-(2,5-difluorophenyl)-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 83936067 |
| Molecular Formula | C15H22F2N2O3 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl N-[3-amino-4-(2,5-difluorophenyl)-4-hydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(N)C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H22F2N2O3/c1-15(2,3)22-14(21)19-7-6-12(18)13(20)10-8-9(16)4-5-11(10)17/h4-5,8,12-13,20H,6-7,18H2,1-3H3,(H,19,21) |
| InChIKey | QYLZPWJDUKBSIO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |