C12H15F2NO3 — CID 171882620
N-[4-(2,5-difluorophenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882620) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is N-[4-(2,5-difluorophenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(2,5-difluorophenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882620 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[4-(2,5-difluorophenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H15F2NO3/c1-7(16)15-5-4-11(17)12(18)9-6-8(13)2-3-10(9)14/h2-3,6,11-12,17-18H,4-5H2,1H3,(H,15,16) |
| InChIKey | ISEJFPBCNBWAIZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |