C14H18FNO4 — CID 171883377
N-[4-(2-acetyl-5-fluorophenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171883377) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is N-[4-(2-acetyl-5-fluorophenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(2-acetyl-5-fluorophenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171883377 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[4-(2-acetyl-5-fluorophenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cc(F)ccc1C(C)=O |
| InChI | InChI=1S/C14H18FNO4/c1-8(17)11-4-3-10(15)7-12(11)14(20)13(19)5-6-16-9(2)18/h3-4,7,13-14,19-20H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | QSBBTSRXRXGEJL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |