C13H15F2NO5 — CID 171883626
4-(4-acetamido-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid (PubChem CID 171883626) has the molecular formula C13H15F2NO5 and a molecular weight of 303.26 g/mol. Its IUPAC name is 4-(4-acetamido-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid.
| Compound Name | 4-(4-acetamido-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 171883626 |
| Molecular Formula | C13H15F2NO5 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-(4-acetamido-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid |
| SMILES | CC(=O)NCCC(O)C(O)c1cc(F)c(C(=O)O)cc1F |
| InChI | InChI=1S/C13H15F2NO5/c1-6(17)16-3-2-11(18)12(19)7-4-10(15)8(13(20)21)5-9(7)14/h4-5,11-12,18-19H,2-3H2,1H3,(H,16,17)(H,20,21) |
| InChIKey | AIBHBFHIELOTMI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |