C12H12F2O5S — CID 170822511
4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid (PubChem CID 170822511) has the molecular formula C12H12F2O5S and a molecular weight of 306.29 g/mol. Its IUPAC name is 4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid.
| Compound Name | 4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 170822511 |
| Molecular Formula | C12H12F2O5S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid |
| SMILES | CC(=O)SCC(O)C(O)c1cc(F)c(C(=O)O)cc1F |
| InChI | InChI=1S/C12H12F2O5S/c1-5(15)20-4-10(16)11(17)6-2-9(14)7(12(18)19)3-8(6)13/h2-3,10-11,16-17H,4H2,1H3,(H,18,19) |
| InChIKey | WRKZCYBYTFVUSM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|