C12H13F2NO5 — CID 170830635
4-(3-acetamido-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid (PubChem CID 170830635) has the molecular formula C12H13F2NO5 and a molecular weight of 289.23 g/mol. Its IUPAC name is 4-(3-acetamido-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid.
| Compound Name | 4-(3-acetamido-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 170830635 |
| Molecular Formula | C12H13F2NO5 |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-(3-acetamido-1,2-dihydroxypropyl)-2,5-difluorobenzoic acid |
| SMILES | CC(=O)NCC(O)C(O)c1cc(F)c(C(=O)O)cc1F |
| InChI | InChI=1S/C12H13F2NO5/c1-5(16)15-4-10(17)11(18)6-2-9(14)7(12(19)20)3-8(6)13/h2-3,10-11,17-18H,4H2,1H3,(H,15,16)(H,19,20) |
| InChIKey | SVFRUBUUWSKYBO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |