C12H14FNO5 — CID 170830326
3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoic acid (PubChem CID 170830326) has the molecular formula C12H14FNO5 and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoic acid.
| Compound Name | 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170830326 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoic acid |
| SMILES | CC(=O)NCC(O)C(O)c1cccc(C(=O)O)c1F |
| InChI | InChI=1S/C12H14FNO5/c1-6(15)14-5-9(16)11(17)7-3-2-4-8(10(7)13)12(18)19/h2-4,9,11,16-17H,5H2,1H3,(H,14,15)(H,18,19) |
| InChIKey | NSDODKZVIXMNDP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |