3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid

C11H12FNO5 — CID 171899442

IUPAC3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid
SMILESNC(=O)CC(O)C(O)c1cccc(C(=O)O)c1F
InChIInChI=1S/C11H12FNO5/c12-9-5(2-1-3-6(9)11(17)18)10(16)7(14)4-8(13)15/h1-3,7,10,14,16H,4H2,(H2,13,15)(H,17,18)
InChIKeyLSXULABORRJYMR-UHFFFAOYSA-N
MW257.22 g/mol
LogP-0.21
Rot. Bonds5

About 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid

3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid (PubChem CID 171899442) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid.

Molecular Properties

Compound Name3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid
PubChem CID171899442
Molecular FormulaC11H12FNO5
Molecular Weight257.22 g/mol
Exact Mass257.07
IUPAC Name3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid
SMILESNC(=O)CC(O)C(O)c1cccc(C(=O)O)c1F
InChIInChI=1S/C11H12FNO5/c12-9-5(2-1-3-6(9)11(17)18)10(16)7(14)4-8(13)15/h1-3,7,10,14,16H,4H2,(H2,13,15)(H,17,18)
InChIKeyLSXULABORRJYMR-UHFFFAOYSA-N
XLogP-0.21
TPSA120.85 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.22
LogP ≤ 5-0.21
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid?
The IUPAC name of 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid (CID 171899442) is 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid.
What is the SMILES notation for 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid?
The canonical SMILES for 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid is NC(=O)CC(O)C(O)c1cccc(C(=O)O)c1F.
What is the InChIKey of 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid?
The InChIKey is LSXULABORRJYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO5/c12-9-5(2-1-3-6(9)11(17)18)10(16)7(14)4-8(13)15/h1-3,7,10,14,16H,4H2,(H2,13,15)(H,17,18).
What are the key properties of 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid?
3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid has a molecular weight of 257.22 g/mol, XLogP of -0.21, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid is sourced from PubChem (CID 171899442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).