C11H12FNO5 — CID 171899442
3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid (PubChem CID 171899442) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid.
| Compound Name | 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 171899442 |
| Molecular Formula | C11H12FNO5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoic acid |
| SMILES | NC(=O)CC(O)C(O)c1cccc(C(=O)O)c1F |
| InChI | InChI=1S/C11H12FNO5/c12-9-5(2-1-3-6(9)11(17)18)10(16)7(14)4-8(13)15/h1-3,7,10,14,16H,4H2,(H2,13,15)(H,17,18) |
| InChIKey | LSXULABORRJYMR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |