C9H10F2N2O3 — CID 171898930
4-(2,6-difluoro-3-pyridinyl)-3,4-dihydroxybutanamide (PubChem CID 171898930) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-pyridinyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(2,6-difluoro-3-pyridinyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171898930 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(2,6-difluoro-3-pyridinyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(F)nc1F |
| InChI | InChI=1S/C9H10F2N2O3/c10-6-2-1-4(9(11)13-6)8(16)5(14)3-7(12)15/h1-2,5,8,14,16H,3H2,(H2,12,15) |
| InChIKey | QUUYRBQZFFTSCG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|