C7H8F2N2O — CID 55294647
2-amino-2-(2,6-difluoro-3-pyridinyl)ethanol (PubChem CID 55294647) has the molecular formula C7H8F2N2O and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-amino-2-(2,6-difluoro-3-pyridinyl)ethanol.
| Compound Name | 2-amino-2-(2,6-difluoro-3-pyridinyl)ethanol |
|---|---|
| PubChem CID | 55294647 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 2-amino-2-(2,6-difluoro-3-pyridinyl)ethanol |
| SMILES | NC(CO)c1ccc(F)nc1F |
| InChI | InChI=1S/C7H8F2N2O/c8-6-2-1-4(5(10)3-12)7(9)11-6/h1-2,5,12H,3,10H2 |
| InChIKey | ONVGLIXXKIXQPV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|