C8H7F2N3 — CID 55294847
3-amino-3-(2,6-difluoro-3-pyridinyl)propanenitrile (PubChem CID 55294847) has the molecular formula C8H7F2N3 and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-amino-3-(2,6-difluoro-3-pyridinyl)propanenitrile.
| Compound Name | 3-amino-3-(2,6-difluoro-3-pyridinyl)propanenitrile |
|---|---|
| PubChem CID | 55294847 |
| Molecular Formula | C8H7F2N3 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3-amino-3-(2,6-difluoro-3-pyridinyl)propanenitrile |
| SMILES | N#CCC(N)c1ccc(F)nc1F |
| InChI | InChI=1S/C8H7F2N3/c9-7-2-1-5(8(10)13-7)6(12)3-4-11/h1-2,6H,3,12H2 |
| InChIKey | XICKSTKHXFAMPO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|