C8H9ClF3NO — CID 171225380
(2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol;hydrochloride (PubChem CID 171225380) has the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol;hydrochloride.
| Compound Name | (2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171225380 |
| Molecular Formula | C8H9ClF3NO |
| Molecular Weight | 227.61 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@@H](CO)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H8F3NO.ClH/c9-5-2-1-4(6(12)3-13)7(10)8(5)11;/h1-2,6,13H,3,12H2;1H/t6-;/m0./s1 |
| InChIKey | IHBZSPUTXOLWOF-RGMNGODLSA-N |
| XLogP | 1.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.61 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|