C11H15ClF3N — CID 171205782
(1R)-1-(2,3,4-trifluorophenyl)pentan-1-amine;hydrochloride (PubChem CID 171205782) has the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. Its IUPAC name is (1R)-1-(2,3,4-trifluorophenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,3,4-trifluorophenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171205782 |
| Molecular Formula | C11H15ClF3N |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (1R)-1-(2,3,4-trifluorophenyl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@@H](N)c1ccc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C11H14F3N.ClH/c1-2-3-4-9(15)7-5-6-8(12)11(14)10(7)13;/h5-6,9H,2-4,15H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | LTRWSUOWCUUBMH-SBSPUUFOSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|