C13H19F3N2 — CID 79087025
N',N'-diethyl-1-(2,3,4-trifluorophenyl)propane-1,3-diamine (PubChem CID 79087025) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N',N'-diethyl-1-(2,3,4-trifluorophenyl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-1-(2,3,4-trifluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 79087025 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N',N'-diethyl-1-(2,3,4-trifluorophenyl)propane-1,3-diamine |
| SMILES | CCN(CC)CCC(N)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H19F3N2/c1-3-18(4-2)8-7-11(17)9-5-6-10(14)13(16)12(9)15/h5-6,11H,3-4,7-8,17H2,1-2H3 |
| InChIKey | RQUGSRSIGCFVKH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|