C13H20F2N2 — CID 79086921
1-(3,4-difluorophenyl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 79086921) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | 1-(3,4-difluorophenyl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79086921 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCC(N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H20F2N2/c1-3-17(4-2)8-7-13(16)10-5-6-11(14)12(15)9-10/h5-6,9,13H,3-4,7-8,16H2,1-2H3 |
| InChIKey | YWGDGAMSZSUZCL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |