C11H17ClF2N2 — CID 171210029
(1R)-1-(3,4-difluorophenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171210029) has the molecular formula C11H17ClF2N2 and a molecular weight of 250.72 g/mol. Its IUPAC name is (1R)-1-(3,4-difluorophenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(3,4-difluorophenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171210029 |
| Molecular Formula | C11H17ClF2N2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1R)-1-(3,4-difluorophenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H16F2N2.ClH/c12-9-5-4-8(7-10(9)13)11(15)3-1-2-6-14;/h4-5,7,11H,1-3,6,14-15H2;1H/t11-;/m1./s1 |
| InChIKey | JLMXLSBJTQJAAK-RFVHGSKJSA-N |
| XLogP | 2.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|