C13H23ClN2 — CID 171200476
(1R)-1-(3,4-dimethylphenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171200476) has the molecular formula C13H23ClN2 and a molecular weight of 242.79 g/mol. Its IUPAC name is (1R)-1-(3,4-dimethylphenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(3,4-dimethylphenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171200476 |
| Molecular Formula | C13H23ClN2 |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1R)-1-(3,4-dimethylphenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)CCCCN)cc1C.Cl |
| InChI | InChI=1S/C13H22N2.ClH/c1-10-6-7-12(9-11(10)2)13(15)5-3-4-8-14;/h6-7,9,13H,3-5,8,14-15H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | AEIVKZOSSRPZEF-BTQNPOSSSA-N |
| XLogP | 2.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|