C13H18F3N — CID 105023906
1-(3,4-dimethylphenyl)-5,5,5-trifluoropentan-1-amine (PubChem CID 105023906) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5,5,5-trifluoropentan-1-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 105023906 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5,5,5-trifluoropentan-1-amine |
| SMILES | Cc1ccc(C(N)CCCC(F)(F)F)cc1C |
| InChI | InChI=1S/C13H18F3N/c1-9-5-6-11(8-10(9)2)12(17)4-3-7-13(14,15)16/h5-6,8,12H,3-4,7,17H2,1-2H3 |
| InChIKey | HSVKNANXSOTZLC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |